About [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate
[7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate (PubChem CID 87486966) has the molecular formula C10H10F3NO3S
and a molecular weight of 281.25 g/mol. Its IUPAC name is [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate |
| PubChem CID | 87486966 |
| Molecular Formula | C10H10F3NO3S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate |
| SMILES | NCC1Cc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C10H10F3NO3S/c11-10(12,13)18(15,16)17-8-1-2-9-6(4-8)3-7(9)5-14/h1-2,4,7H,3,5,14H2 |
| InChIKey | QNUYCIZEIPLCLC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate?
The IUPAC name of [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate (CID 87486966) is [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate.
What is the SMILES notation for [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate?
The canonical SMILES for [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate is NCC1Cc2cc(OS(=O)(=O)C(F)(F)F)ccc21.
What is the InChIKey of [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate?
The InChIKey is QNUYCIZEIPLCLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO3S/c11-10(12,13)18(15,16)17-8-1-2-9-6(4-8)3-7(9)5-14/h1-2,4,7H,3,5,14H2.
What are the key properties of [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate?
[7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate has a molecular weight of 281.25 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(aminomethyl)-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] trifluoromethanesulfonate is sourced from PubChem (CID 87486966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).