C23H25N3O4S2 — CID 87487305
N-benzyl-N-[(1R,2R)-2-hydroxycyclohexyl]-4-(1,3-thiazol-2-ylsulfamoyl)benzamide (PubChem CID 87487305) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-benzyl-N-[(1R,2R)-2-hydroxycyclohexyl]-4-(1,3-thiazol-2-ylsulfamoyl)benzamide.
| Compound Name | N-benzyl-N-[(1R,2R)-2-hydroxycyclohexyl]-4-(1,3-thiazol-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 87487305 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-benzyl-N-[(1R,2R)-2-hydroxycyclohexyl]-4-(1,3-thiazol-2-ylsulfamoyl)benzamide |
| SMILES | O=C(c1ccc(S(=O)(=O)Nc2nccs2)cc1)N(Cc1ccccc1)[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C23H25N3O4S2/c27-21-9-5-4-8-20(21)26(16-17-6-2-1-3-7-17)22(28)18-10-12-19(13-11-18)32(29,30)25-23-24-14-15-31-23/h1-3,6-7,10-15,20-21,27H,4-5,8-9,16H2,(H,24,25)/t20-,21-/m1/s1 |
| InChIKey | TYVCIAKLDFXFNV-NHCUHLMSSA-N |
| XLogP | 3.89 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |