C13H15NO2 — CID 87487327
methyl 2-[benzyl(prop-2-ynyl)amino]acetate (PubChem CID 87487327) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is methyl 2-[benzyl(prop-2-ynyl)amino]acetate.
| Compound Name | methyl 2-[benzyl(prop-2-ynyl)amino]acetate |
|---|---|
| PubChem CID | 87487327 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | methyl 2-[benzyl(prop-2-ynyl)amino]acetate |
| SMILES | C#CCN(CC(=O)OC)Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c1-3-9-14(11-13(15)16-2)10-12-7-5-4-6-8-12/h1,4-8H,9-11H2,2H3 |
| InChIKey | YSVTWOHNYCMEFM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|