C29H60O3Si3 — CID 87487344
tert-butyl-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-ynoxy]-dimethylsilane (PubChem CID 87487344) has the molecular formula C29H60O3Si3 and a molecular weight of 541.05 g/mol. Its IUPAC name is tert-butyl-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 87487344 |
| Molecular Formula | C29H60O3Si3 |
| Molecular Weight | 541.05 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | tert-butyl-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCO[Si](C)(C)C(C)(C)C)[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O3Si3/c1-18-21-26(32-35(16,17)29(9,10)11)24(22-20-23-30-33(12,13)27(3,4)5)25(19-2)31-34(14,15)28(6,7)8/h1,19,24-26H,2,20-23H2,3-17H3/t24-,25-,26+/m0/s1 |
| InChIKey | UANSYTKAJWYCJS-KKUQBAQOSA-N |
| XLogP | 9.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.05 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|