About 1,2-bis(ethenoxy)butane
1,2-bis(ethenoxy)butane (PubChem CID 87487432) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1,2-bis(ethenoxy)butane.
Molecular Properties
| Compound Name | 1,2-bis(ethenoxy)butane |
| PubChem CID | 87487432 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 1,2-bis(ethenoxy)butane |
| SMILES | C=COCC(CC)OC=C |
| InChI | InChI=1S/C8H14O2/c1-4-8(10-6-3)7-9-5-2/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | QDXYBNYKACUCOJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(ethenoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(ethenoxy)butane?
The IUPAC name of 1,2-bis(ethenoxy)butane (CID 87487432) is 1,2-bis(ethenoxy)butane.
What is the SMILES notation for 1,2-bis(ethenoxy)butane?
The canonical SMILES for 1,2-bis(ethenoxy)butane is C=COCC(CC)OC=C.
What is the InChIKey of 1,2-bis(ethenoxy)butane?
The InChIKey is QDXYBNYKACUCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-4-8(10-6-3)7-9-5-2/h5-6,8H,2-4,7H2,1H3.
What are the key properties of 1,2-bis(ethenoxy)butane?
1,2-bis(ethenoxy)butane has a molecular weight of 142.20 g/mol, XLogP of 2.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(ethenoxy)butane is sourced from PubChem (CID 87487432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).