C14H8N4O6 — CID 87487997
2-(2,6-dinitrophenyl)-3H-benzimidazole-5-carboxylic acid (PubChem CID 87487997) has the molecular formula C14H8N4O6 and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-(2,6-dinitrophenyl)-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-(2,6-dinitrophenyl)-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 87487997 |
| Molecular Formula | C14H8N4O6 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-(2,6-dinitrophenyl)-3H-benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-c3c([N+](=O)[O-])cccc3[N+](=O)[O-])[nH]c2c1 |
| InChI | InChI=1S/C14H8N4O6/c19-14(20)7-4-5-8-9(6-7)16-13(15-8)12-10(17(21)22)2-1-3-11(12)18(23)24/h1-6H,(H,15,16)(H,19,20) |
| InChIKey | PXPVAPQGWPSFSX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|