About 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide
4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 87488556) has the molecular formula C18H14F3N3O4S2
and a molecular weight of 457.46 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
Molecular Properties
| Compound Name | 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| PubChem CID | 87488556 |
| Molecular Formula | C18H14F3N3O4S2 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C18H14F3N3O4S2/c19-18(20,21)28-14-5-1-12(2-6-14)11-23-16(25)13-3-7-15(8-4-13)30(26,27)24-17-22-9-10-29-17/h1-10H,11H2,(H,22,24)(H,23,25) |
| InChIKey | KJLODJGQAIHSCK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide?
The IUPAC name of 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (CID 87488556) is 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
What is the SMILES notation for 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide?
The canonical SMILES for 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide is O=C(NCc1ccc(OC(F)(F)F)cc1)c1ccc(S(=O)(=O)Nc2nccs2)cc1.
What is the InChIKey of 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide?
The InChIKey is KJLODJGQAIHSCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3N3O4S2/c19-18(20,21)28-14-5-1-12(2-6-14)11-23-16(25)13-3-7-15(8-4-13)30(26,27)24-17-22-9-10-29-17/h1-10H,11H2,(H,22,24)(H,23,25).
What are the key properties of 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide?
4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide has a molecular weight of 457.46 g/mol, XLogP of 3.77, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-thiazol-2-ylsulfamoyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide is sourced from PubChem (CID 87488556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).