About [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate
[2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate (PubChem CID 87488581) has the molecular formula C22H19N3O10S2
and a molecular weight of 549.54 g/mol. Its IUPAC name is [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate |
| PubChem CID | 87488581 |
| Molecular Formula | C22H19N3O10S2 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Oc1ccccc1C1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CCO1 |
| InChI | InChI=1S/C22H19N3O10S2/c26-24(27)17-8-2-5-11-21(17)36(30,31)23-13-14-34-20(15-23)16-7-1-4-10-19(16)35-37(32,33)22-12-6-3-9-18(22)25(28)29/h1-12,20H,13-15H2 |
| InChIKey | FIDXVRKGOLVXGN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate?
The IUPAC name of [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate (CID 87488581) is [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate.
What is the SMILES notation for [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate?
The canonical SMILES for [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate is O=[N+]([O-])c1ccccc1S(=O)(=O)Oc1ccccc1C1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CCO1.
What is the InChIKey of [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate?
The InChIKey is FIDXVRKGOLVXGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O10S2/c26-24(27)17-8-2-5-11-21(17)36(30,31)23-13-14-34-20(15-23)16-7-1-4-10-19(16)35-37(32,33)22-12-6-3-9-18(22)25(28)29/h1-12,20H,13-15H2.
What are the key properties of [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate?
[2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate has a molecular weight of 549.54 g/mol, XLogP of 3.03, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(2-nitrophenyl)sulfonylmorpholin-2-yl]phenyl] 2-nitrobenzenesulfonate is sourced from PubChem (CID 87488581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).