About (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide
(2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide (PubChem CID 87488611) has the molecular formula C11H9F6NO
and a molecular weight of 285.19 g/mol. Its IUPAC name is (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide.
Molecular Properties
| Compound Name | (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide |
| PubChem CID | 87488611 |
| Molecular Formula | C11H9F6NO |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@H](C(N)=O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C11H9F6NO/c1-5(9(18)19)7-4-6(10(12,13)14)2-3-8(7)11(15,16)17/h2-5H,1H3,(H2,18,19)/t5-/m1/s1 |
| InChIKey | VJHQEOUXCOUQSM-RXMQYKEDSA-N |
| XLogP | 3.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide?
The IUPAC name of (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide (CID 87488611) is (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide.
What is the SMILES notation for (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide?
The canonical SMILES for (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide is C[C@@H](C(N)=O)c1cc(C(F)(F)F)ccc1C(F)(F)F.
What is the InChIKey of (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide?
The InChIKey is VJHQEOUXCOUQSM-RXMQYKEDSA-N. The full InChI is InChI=1S/C11H9F6NO/c1-5(9(18)19)7-4-6(10(12,13)14)2-3-8(7)11(15,16)17/h2-5H,1H3,(H2,18,19)/t5-/m1/s1.
What are the key properties of (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide?
(2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide has a molecular weight of 285.19 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2,5-bis(trifluoromethyl)phenyl]propanamide is sourced from PubChem (CID 87488611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).