About azane;methyl 9-octylheptadecane-9-sulfonate
azane;methyl 9-octylheptadecane-9-sulfonate (PubChem CID 87488633) has the molecular formula C26H57NO3S
and a molecular weight of 463.81 g/mol. Its IUPAC name is azane;methyl 9-octylheptadecane-9-sulfonate.
Molecular Properties
| Compound Name | azane;methyl 9-octylheptadecane-9-sulfonate |
| PubChem CID | 87488633 |
| Molecular Formula | C26H57NO3S |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 463.41 |
| IUPAC Name | azane;methyl 9-octylheptadecane-9-sulfonate |
| SMILES | CCCCCCCCC(CCCCCCCC)(CCCCCCCC)S(=O)(=O)OC.N |
| InChI | InChI=1S/C26H54O3S.H3N/c1-5-8-11-14-17-20-23-26(30(27,28)29-4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;/h5-25H2,1-4H3;1H3 |
| InChIKey | IUBQHSJBBWXFOG-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl 9-octylheptadecane-9-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl 9-octylheptadecane-9-sulfonate?
The IUPAC name of azane;methyl 9-octylheptadecane-9-sulfonate (CID 87488633) is azane;methyl 9-octylheptadecane-9-sulfonate.
What is the SMILES notation for azane;methyl 9-octylheptadecane-9-sulfonate?
The canonical SMILES for azane;methyl 9-octylheptadecane-9-sulfonate is CCCCCCCCC(CCCCCCCC)(CCCCCCCC)S(=O)(=O)OC.N.
What is the InChIKey of azane;methyl 9-octylheptadecane-9-sulfonate?
The InChIKey is IUBQHSJBBWXFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H54O3S.H3N/c1-5-8-11-14-17-20-23-26(30(27,28)29-4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;/h5-25H2,1-4H3;1H3.
What are the key properties of azane;methyl 9-octylheptadecane-9-sulfonate?
azane;methyl 9-octylheptadecane-9-sulfonate has a molecular weight of 463.81 g/mol, XLogP of 9.12, 23 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl 9-octylheptadecane-9-sulfonate is sourced from PubChem (CID 87488633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).