About N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid
N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid (PubChem CID 87488672) has the molecular formula C15H24N2O5
and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid.
Molecular Properties
| Compound Name | N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid |
| PubChem CID | 87488672 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid |
| SMILES | C=CC(=O)NC(C)(C)CC(C)=O.C=CC(=O)NCCC(=O)O |
| InChI | InChI=1S/C9H15NO2.C6H9NO3/c1-5-8(12)10-9(3,4)6-7(2)11;1-2-5(8)7-4-3-6(9)10/h5H,1,6H2,2-4H3,(H,10,12);2H,1,3-4H2,(H,7,8)(H,9,10) |
| InChIKey | HMKBAGDQILFRSE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid?
The IUPAC name of N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid (CID 87488672) is N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid.
What is the SMILES notation for N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid?
The canonical SMILES for N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid is C=CC(=O)NC(C)(C)CC(C)=O.C=CC(=O)NCCC(=O)O.
What is the InChIKey of N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid?
The InChIKey is HMKBAGDQILFRSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.C6H9NO3/c1-5-8(12)10-9(3,4)6-7(2)11;1-2-5(8)7-4-3-6(9)10/h5H,1,6H2,2-4H3,(H,10,12);2H,1,3-4H2,(H,7,8)(H,9,10).
What are the key properties of N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid?
N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid has a molecular weight of 312.37 g/mol, XLogP of 0.81, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide;3-(prop-2-enoylamino)propanoic acid is sourced from PubChem (CID 87488672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).