C13H22O5 — CID 87488819
2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]-3,3-dimethylbutanoic acid (PubChem CID 87488819) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87488819 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]-3,3-dimethylbutanoic acid |
| SMILES | CC1(C)O[C@H](C=O)C[C@H](C(C(=O)O)C(C)(C)C)O1 |
| InChI | InChI=1S/C13H22O5/c1-12(2,3)10(11(15)16)9-6-8(7-14)17-13(4,5)18-9/h7-10H,6H2,1-5H3,(H,15,16)/t8-,9+,10?/m0/s1 |
| InChIKey | NQTWWXIJLOBVLC-QIIDTADFSA-N |
| XLogP | 1.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|