C11H28N4O — CID 87489106
1-N',1-N'-dimethylpropane-1,1-diamine;1-N'-(oxiran-2-ylmethyl)propane-1,1-diamine (PubChem CID 87489106) has the molecular formula C11H28N4O and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-N',1-N'-dimethylpropane-1,1-diamine;1-N'-(oxiran-2-ylmethyl)propane-1,1-diamine.
| Compound Name | 1-N',1-N'-dimethylpropane-1,1-diamine;1-N'-(oxiran-2-ylmethyl)propane-1,1-diamine |
|---|---|
| PubChem CID | 87489106 |
| Molecular Formula | C11H28N4O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.23 |
| IUPAC Name | 1-N',1-N'-dimethylpropane-1,1-diamine;1-N'-(oxiran-2-ylmethyl)propane-1,1-diamine |
| SMILES | CCC(N)N(C)C.CCC(N)NCC1CO1 |
| InChI | InChI=1S/C6H14N2O.C5H14N2/c1-2-6(7)8-3-5-4-9-5;1-4-5(6)7(2)3/h5-6,8H,2-4,7H2,1H3;5H,4,6H2,1-3H3 |
| InChIKey | MTMGWRGZGGYKFC-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|