About azane;(dicyclohexylamino) nitrite
azane;(dicyclohexylamino) nitrite (PubChem CID 87489236) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is azane;(dicyclohexylamino) nitrite.
Molecular Properties
| Compound Name | azane;(dicyclohexylamino) nitrite |
| PubChem CID | 87489236 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | azane;(dicyclohexylamino) nitrite |
| SMILES | N.O=NON(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C12H22N2O2.H3N/c15-13-16-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h11-12H,1-10H2;1H3 |
| InChIKey | NMKIQKHEGNPTMC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;(dicyclohexylamino) nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(dicyclohexylamino) nitrite?
The IUPAC name of azane;(dicyclohexylamino) nitrite (CID 87489236) is azane;(dicyclohexylamino) nitrite.
What is the SMILES notation for azane;(dicyclohexylamino) nitrite?
The canonical SMILES for azane;(dicyclohexylamino) nitrite is N.O=NON(C1CCCCC1)C1CCCCC1.
What is the InChIKey of azane;(dicyclohexylamino) nitrite?
The InChIKey is NMKIQKHEGNPTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2.H3N/c15-13-16-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h11-12H,1-10H2;1H3.
What are the key properties of azane;(dicyclohexylamino) nitrite?
azane;(dicyclohexylamino) nitrite has a molecular weight of 243.35 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(dicyclohexylamino) nitrite is sourced from PubChem (CID 87489236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).