About (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid
(4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid (PubChem CID 87489677) has the molecular formula C14H18N4O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid.
Molecular Properties
| Compound Name | (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid |
| PubChem CID | 87489677 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid |
| SMILES | O=C(O)NCC1CCC(c2ncn3ccncc23)CC1 |
| InChI | InChI=1S/C14H18N4O2/c19-14(20)16-7-10-1-3-11(4-2-10)13-12-8-15-5-6-18(12)9-17-13/h5-6,8-11,16H,1-4,7H2,(H,19,20) |
| InChIKey | TVQASOVJVNYAAU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid?
The IUPAC name of (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid (CID 87489677) is (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid.
What is the SMILES notation for (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid?
The canonical SMILES for (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid is O=C(O)NCC1CCC(c2ncn3ccncc23)CC1.
What is the InChIKey of (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid?
The InChIKey is TVQASOVJVNYAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2/c19-14(20)16-7-10-1-3-11(4-2-10)13-12-8-15-5-6-18(12)9-17-13/h5-6,8-11,16H,1-4,7H2,(H,19,20).
What are the key properties of (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid?
(4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid has a molecular weight of 274.32 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-imidazo[1,5-a]pyrazin-1-ylcyclohexyl)methylcarbamic acid is sourced from PubChem (CID 87489677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).