About 1-(5-bromo-2,4-difluorophenyl)ethanimine
1-(5-bromo-2,4-difluorophenyl)ethanimine (PubChem CID 87490060) has the molecular formula C8H6BrF2N
and a molecular weight of 234.04 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)ethanimine.
Molecular Properties
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)ethanimine |
| PubChem CID | 87490060 |
| Molecular Formula | C8H6BrF2N |
| Molecular Weight | 234.04 g/mol |
| Exact Mass | 232.97 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)ethanimine |
| SMILES | [H]/N=C(\C)c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C8H6BrF2N/c1-4(12)5-2-6(9)8(11)3-7(5)10/h2-3,12H,1H3/b12-4+ |
| InChIKey | MITPBFFYYNUZTQ-UUILKARUSA-N |
| XLogP | 3.12 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.04 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromo-2,4-difluorophenyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2,4-difluorophenyl)ethanimine?
The IUPAC name of 1-(5-bromo-2,4-difluorophenyl)ethanimine (CID 87490060) is 1-(5-bromo-2,4-difluorophenyl)ethanimine.
What is the SMILES notation for 1-(5-bromo-2,4-difluorophenyl)ethanimine?
The canonical SMILES for 1-(5-bromo-2,4-difluorophenyl)ethanimine is [H]/N=C(\C)c1cc(Br)c(F)cc1F.
What is the InChIKey of 1-(5-bromo-2,4-difluorophenyl)ethanimine?
The InChIKey is MITPBFFYYNUZTQ-UUILKARUSA-N. The full InChI is InChI=1S/C8H6BrF2N/c1-4(12)5-2-6(9)8(11)3-7(5)10/h2-3,12H,1H3/b12-4+.
What are the key properties of 1-(5-bromo-2,4-difluorophenyl)ethanimine?
1-(5-bromo-2,4-difluorophenyl)ethanimine has a molecular weight of 234.04 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2,4-difluorophenyl)ethanimine is sourced from PubChem (CID 87490060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).