C33H36F2O3S2 — CID 87490070
2,6-difluorobenzenesulfonate;diphenyl-(2,4,6-tripropylphenyl)sulfanium (PubChem CID 87490070) has the molecular formula C33H36F2O3S2 and a molecular weight of 582.78 g/mol. Its IUPAC name is 2,6-difluorobenzenesulfonate;diphenyl-(2,4,6-tripropylphenyl)sulfanium.
| Compound Name | 2,6-difluorobenzenesulfonate;diphenyl-(2,4,6-tripropylphenyl)sulfanium |
|---|---|
| PubChem CID | 87490070 |
| Molecular Formula | C33H36F2O3S2 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 2,6-difluorobenzenesulfonate;diphenyl-(2,4,6-tripropylphenyl)sulfanium |
| SMILES | CCCc1cc(CCC)c([S+](c2ccccc2)c2ccccc2)c(CCC)c1.O=S(=O)([O-])c1c(F)cccc1F |
| InChI | InChI=1S/C27H33S.C6H4F2O3S/c1-4-13-22-20-23(14-5-2)27(24(21-22)15-6-3)28(25-16-9-7-10-17-25)26-18-11-8-12-19-26;7-4-2-1-3-5(8)6(4)12(9,10)11/h7-12,16-21H,4-6,13-15H2,1-3H3;1-3H,(H,9,10,11)/q+1;/p-1 |
| InChIKey | IBBDVXMCVPNIOI-UHFFFAOYSA-M |
| XLogP | 8.51 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|