About tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane
tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane (PubChem CID 87490196) has the molecular formula C60H51BiS3
and a molecular weight of 1077.25 g/mol. Its IUPAC name is tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane.
Molecular Properties
| Compound Name | tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane |
| PubChem CID | 87490196 |
| Molecular Formula | C60H51BiS3 |
| Molecular Weight | 1077.25 g/mol |
| Exact Mass | 1076.30 |
| IUPAC Name | tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane |
| SMILES | Cc1ccc(-c2cccc(-c3ccc(C)cc3)c2S[Bi](Sc2c(-c3ccc(C)cc3)cccc2-c2ccc(C)cc2)Sc2c(-c3ccc(C)cc3)cccc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/3C20H18S.Bi/c3*1-14-6-10-16(11-7-14)18-4-3-5-19(20(18)21)17-12-8-15(2)9-13-17;/h3*3-13,21H,1-2H3;/q;;;+3/p-3 |
| InChIKey | GAAKTNYKWBRFBI-UHFFFAOYSA-K |
| XLogP | 18.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1077.25 |
| LogP ≤ 5 | 18.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane?
The IUPAC name of tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane (CID 87490196) is tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane.
What is the SMILES notation for tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane?
The canonical SMILES for tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane is Cc1ccc(-c2cccc(-c3ccc(C)cc3)c2S[Bi](Sc2c(-c3ccc(C)cc3)cccc2-c2ccc(C)cc2)Sc2c(-c3ccc(C)cc3)cccc2-c2ccc(C)cc2)cc1.
What is the InChIKey of tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane?
The InChIKey is GAAKTNYKWBRFBI-UHFFFAOYSA-K. The full InChI is InChI=1S/3C20H18S.Bi/c3*1-14-6-10-16(11-7-14)18-4-3-5-19(20(18)21)17-12-8-15(2)9-13-17;/h3*3-13,21H,1-2H3;/q;;;+3/p-3.
What are the key properties of tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane?
tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane has a molecular weight of 1077.25 g/mol, XLogP of 18.20, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris[[2,6-bis(4-methylphenyl)phenyl]sulfanyl]bismuthane is sourced from PubChem (CID 87490196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).