C20H22F3N3O — CID 87490417
N'-[2,5-dimethyl-4-[(E)-[3-(trifluoromethyl)phenyl]methoxyiminomethyl]phenyl]-N,N-dimethylmethanimidamide (PubChem CID 87490417) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[(E)-[3-(trifluoromethyl)phenyl]methoxyiminomethyl]phenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[(E)-[3-(trifluoromethyl)phenyl]methoxyiminomethyl]phenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 87490417 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N'-[2,5-dimethyl-4-[(E)-[3-(trifluoromethyl)phenyl]methoxyiminomethyl]phenyl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1cc(/N=C/N(C)C)c(C)cc1/C=N/OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3N3O/c1-14-9-19(24-13-26(3)4)15(2)8-17(14)11-25-27-12-16-6-5-7-18(10-16)20(21,22)23/h5-11,13H,12H2,1-4H3/b24-13+,25-11+ |
| InChIKey | VQMQGRDOCYEHMZ-MSQYTUQRSA-N |
| XLogP | 5.09 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|