C15H11NO — CID 87490799
(1E,9Z,11Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,5,7,9,11,13,15-heptaen-3-one (PubChem CID 87490799) has the molecular formula C15H11NO and a molecular weight of 221.26 g/mol. Its IUPAC name is (1E,9Z,11Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,5,7,9,11,13,15-heptaen-3-one.
| Compound Name | (1E,9Z,11Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,5,7,9,11,13,15-heptaen-3-one |
|---|---|
| PubChem CID | 87490799 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (1E,9Z,11Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,5,7,9,11,13,15-heptaen-3-one |
| SMILES | O=C1CC=C/C2=N/C=C\C=c3\cccc\c3=C\12 |
| InChI | InChI=1S/C15H11NO/c17-14-9-3-8-13-15(14)12-7-2-1-5-11(12)6-4-10-16-13/h1-8,10H,9H2/b6-4-,10-4-,11-6-,15-12+,16-10-,16-13- |
| InChIKey | SMLMZZPTCOGHDZ-VUHMXLTKSA-N |
| XLogP | 1.12 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |