C44H42S2 — CID 87490839
2-[[2,6-bis(2,5-dimethylphenyl)phenyl]disulfanyl]-1,3-bis(2,5-dimethylphenyl)benzene (PubChem CID 87490839) has the molecular formula C44H42S2 and a molecular weight of 634.95 g/mol. Its IUPAC name is 2-[[2,6-bis(2,5-dimethylphenyl)phenyl]disulfanyl]-1,3-bis(2,5-dimethylphenyl)benzene.
| Compound Name | 2-[[2,6-bis(2,5-dimethylphenyl)phenyl]disulfanyl]-1,3-bis(2,5-dimethylphenyl)benzene |
|---|---|
| PubChem CID | 87490839 |
| Molecular Formula | C44H42S2 |
| Molecular Weight | 634.95 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 2-[[2,6-bis(2,5-dimethylphenyl)phenyl]disulfanyl]-1,3-bis(2,5-dimethylphenyl)benzene |
| SMILES | Cc1ccc(C)c(-c2cccc(-c3cc(C)ccc3C)c2SSc2c(-c3cc(C)ccc3C)cccc2-c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C44H42S2/c1-27-15-19-31(5)39(23-27)35-11-9-12-36(40-24-28(2)16-20-32(40)6)43(35)45-46-44-37(41-25-29(3)17-21-33(41)7)13-10-14-38(44)42-26-30(4)18-22-34(42)8/h9-26H,1-8H3 |
| InChIKey | SOZSWPMRACRLJD-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.95 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|