About cyclotetradecane-1,2,3,4-tetrathione
cyclotetradecane-1,2,3,4-tetrathione (PubChem CID 87490908) has the molecular formula C14H20S4
and a molecular weight of 316.58 g/mol. Its IUPAC name is cyclotetradecane-1,2,3,4-tetrathione.
Molecular Properties
| Compound Name | cyclotetradecane-1,2,3,4-tetrathione |
| PubChem CID | 87490908 |
| Molecular Formula | C14H20S4 |
| Molecular Weight | 316.58 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | cyclotetradecane-1,2,3,4-tetrathione |
| SMILES | S=C1CCCCCCCCCCC(=S)C(=S)C1=S |
| InChI | InChI=1S/C14H20S4/c15-11-9-7-5-3-1-2-4-6-8-10-12(16)14(18)13(11)17/h1-10H2 |
| InChIKey | MSZSJOMUDPLESW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cyclotetradecane-1,2,3,4-tetrathione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclotetradecane-1,2,3,4-tetrathione?
The IUPAC name of cyclotetradecane-1,2,3,4-tetrathione (CID 87490908) is cyclotetradecane-1,2,3,4-tetrathione.
What is the SMILES notation for cyclotetradecane-1,2,3,4-tetrathione?
The canonical SMILES for cyclotetradecane-1,2,3,4-tetrathione is S=C1CCCCCCCCCCC(=S)C(=S)C1=S.
What is the InChIKey of cyclotetradecane-1,2,3,4-tetrathione?
The InChIKey is MSZSJOMUDPLESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20S4/c15-11-9-7-5-3-1-2-4-6-8-10-12(16)14(18)13(11)17/h1-10H2.
What are the key properties of cyclotetradecane-1,2,3,4-tetrathione?
cyclotetradecane-1,2,3,4-tetrathione has a molecular weight of 316.58 g/mol, XLogP of 5.38, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclotetradecane-1,2,3,4-tetrathione is sourced from PubChem (CID 87490908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).