C25H41NO8 — CID 87491006
benzyl 2-(1,1,6,6,6-pentahydroxyhexylcarbamoyl)undecanoate (PubChem CID 87491006) has the molecular formula C25H41NO8 and a molecular weight of 483.60 g/mol. Its IUPAC name is benzyl 2-(1,1,6,6,6-pentahydroxyhexylcarbamoyl)undecanoate.
| Compound Name | benzyl 2-(1,1,6,6,6-pentahydroxyhexylcarbamoyl)undecanoate |
|---|---|
| PubChem CID | 87491006 |
| Molecular Formula | C25H41NO8 |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | benzyl 2-(1,1,6,6,6-pentahydroxyhexylcarbamoyl)undecanoate |
| SMILES | CCCCCCCCCC(C(=O)NC(O)(O)CCCCC(O)(O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H41NO8/c1-2-3-4-5-6-7-11-16-21(23(28)34-19-20-14-9-8-10-15-20)22(27)26-24(29,30)17-12-13-18-25(31,32)33/h8-10,14-15,21,29-33H,2-7,11-13,16-19H2,1H3,(H,26,27) |
| InChIKey | BMWVCYQYUOAWEY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|