About (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione
(3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione (PubChem CID 87491017) has the molecular formula C11H17NO4S
and a molecular weight of 259.33 g/mol. Its IUPAC name is (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione.
Molecular Properties
| Compound Name | (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione |
| PubChem CID | 87491017 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione |
| SMILES | O=C1CCCCCC(=O)OC(=O)[C@H](CCS)N1 |
| InChI | InChI=1S/C11H17NO4S/c13-9-4-2-1-3-5-10(14)16-11(15)8(12-9)6-7-17/h8,17H,1-7H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | BXYUZKJAHKQNMD-QMMMGPOBSA-N |
| XLogP | 0.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione?
The IUPAC name of (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione (CID 87491017) is (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione.
What is the SMILES notation for (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione?
The canonical SMILES for (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione is O=C1CCCCCC(=O)OC(=O)[C@H](CCS)N1.
What is the InChIKey of (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione?
The InChIKey is BXYUZKJAHKQNMD-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H17NO4S/c13-9-4-2-1-3-5-10(14)16-11(15)8(12-9)6-7-17/h8,17H,1-7H2,(H,12,13)/t8-/m0/s1.
What are the key properties of (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione?
(3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione has a molecular weight of 259.33 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(2-sulfanylethyl)-1-oxa-4-azacycloundecane-2,5,11-trione is sourced from PubChem (CID 87491017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).