About 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride
1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride (PubChem CID 87491052) has the molecular formula C15H18Cl2OTi
and a molecular weight of 333.08 g/mol. Its IUPAC name is 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride.
Molecular Properties
| Compound Name | 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride |
| PubChem CID | 87491052 |
| Molecular Formula | C15H18Cl2OTi |
| Molecular Weight | 333.08 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride |
| SMILES | CC1=CCC(c2ccccc2C(C)O)=C1C.[Cl-].[Cl-].[Ti+2] |
| InChI | InChI=1S/C15H18O.2ClH.Ti/c1-10-8-9-13(11(10)2)15-7-5-4-6-14(15)12(3)16;;;/h4-8,12,16H,9H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | OZEDZSCHANFDHJ-UHFFFAOYSA-L |
| XLogP | -2.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.08 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride?
The IUPAC name of 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride (CID 87491052) is 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride.
What is the SMILES notation for 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride?
The canonical SMILES for 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride is CC1=CCC(c2ccccc2C(C)O)=C1C.[Cl-].[Cl-].[Ti+2].
What is the InChIKey of 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride?
The InChIKey is OZEDZSCHANFDHJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H18O.2ClH.Ti/c1-10-8-9-13(11(10)2)15-7-5-4-6-14(15)12(3)16;;;/h4-8,12,16H,9H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride?
1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride has a molecular weight of 333.08 g/mol, XLogP of -2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,3-dimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanol;titanium(2+);dichloride is sourced from PubChem (CID 87491052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).