C17H28O5Si — CID 87491113
(1R,2R,6S,7R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 87491113) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is (1R,2R,6S,7R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 87491113 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (1R,2R,6S,7R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@]12CC[C@@](C)(O1)[C@H]1C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C17H28O5Si/c1-15(2,3)23(5,6)20-10-9-17-8-7-16(4,22-17)11-12(17)14(19)21-13(11)18/h11-12H,7-10H2,1-6H3/t11-,12+,16-,17-/m1/s1 |
| InChIKey | GTNPABPNBWQLHD-CZAMWMTLSA-N |
| XLogP | 3.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|