C20H38O2 — CID 87491154
(3E,5Z)-16,16-diethoxyhexadeca-3,5-diene (PubChem CID 87491154) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is (3E,5Z)-16,16-diethoxyhexadeca-3,5-diene.
| Compound Name | (3E,5Z)-16,16-diethoxyhexadeca-3,5-diene |
|---|---|
| PubChem CID | 87491154 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (3E,5Z)-16,16-diethoxyhexadeca-3,5-diene |
| SMILES | CC/C=C/C=C\CCCCCCCCCC(OCC)OCC |
| InChI | InChI=1S/C20H38O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21-5-2)22-6-3/h7-10,20H,4-6,11-19H2,1-3H3/b8-7+,10-9- |
| InChIKey | CBJGIKWGCGTVMA-GOJKSUSPSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|