C14H16F8O2 — CID 87491295
3,5,5-trimethyl-2-(1,1,2,2,3,3,4,4-octafluoropentoxy)cyclohex-2-en-1-one (PubChem CID 87491295) has the molecular formula C14H16F8O2 and a molecular weight of 368.26 g/mol. Its IUPAC name is 3,5,5-trimethyl-2-(1,1,2,2,3,3,4,4-octafluoropentoxy)cyclohex-2-en-1-one.
| Compound Name | 3,5,5-trimethyl-2-(1,1,2,2,3,3,4,4-octafluoropentoxy)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 87491295 |
| Molecular Formula | C14H16F8O2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3,5,5-trimethyl-2-(1,1,2,2,3,3,4,4-octafluoropentoxy)cyclohex-2-en-1-one |
| SMILES | CC1=C(OC(F)(F)C(F)(F)C(F)(F)C(C)(F)F)C(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C14H16F8O2/c1-7-5-10(2,3)6-8(23)9(7)24-14(21,22)13(19,20)12(17,18)11(4,15)16/h5-6H2,1-4H3 |
| InChIKey | AXUYNLFCMMSKLH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|