C14H18N4O4 — CID 87491311
2-aminoacetic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 87491311) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-aminoacetic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-aminoacetic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87491311 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-aminoacetic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | NCC(=O)O.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C2H5NO2/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;3-1-2(4)5/h7H,1-6H2;1,3H2,(H,4,5) |
| InChIKey | LSLKZYVGRSQURD-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|