About N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde
N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde (PubChem CID 87491424) has the molecular formula C25H21N3OS
and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde.
Molecular Properties
| Compound Name | N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde |
| PubChem CID | 87491424 |
| Molecular Formula | C25H21N3OS |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde |
| SMILES | C(=NC(N=Cc1ccccc1)c1ccccc1)c1ccccc1.O=Cc1nccs1 |
| InChI | InChI=1S/C21H18N2.C4H3NOS/c1-4-10-18(11-5-1)16-22-21(20-14-8-3-9-15-20)23-17-19-12-6-2-7-13-19;6-3-4-5-1-2-7-4/h1-17,21H;1-3H |
| InChIKey | XLIXMTOCQWTEOC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde?
The IUPAC name of N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde (CID 87491424) is N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde.
What is the SMILES notation for N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde?
The canonical SMILES for N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde is C(=NC(N=Cc1ccccc1)c1ccccc1)c1ccccc1.O=Cc1nccs1.
What is the InChIKey of N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde?
The InChIKey is XLIXMTOCQWTEOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2.C4H3NOS/c1-4-10-18(11-5-1)16-22-21(20-14-8-3-9-15-20)23-17-19-12-6-2-7-13-19;6-3-4-5-1-2-7-4/h1-17,21H;1-3H.
What are the key properties of N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde?
N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde has a molecular weight of 411.53 g/mol, XLogP of 5.88, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(benzylideneamino)-phenylmethyl]-1-phenylmethanimine;1,3-thiazole-2-carbaldehyde is sourced from PubChem (CID 87491424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).