C16H14N4O4 — CID 87491503
1,5-bis(2,2-diisocyanatoethyl)-2,4-dimethylbenzene (PubChem CID 87491503) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1,5-bis(2,2-diisocyanatoethyl)-2,4-dimethylbenzene.
| Compound Name | 1,5-bis(2,2-diisocyanatoethyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 87491503 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1,5-bis(2,2-diisocyanatoethyl)-2,4-dimethylbenzene |
| SMILES | Cc1cc(C)c(CC(N=C=O)N=C=O)cc1CC(N=C=O)N=C=O |
| InChI | InChI=1S/C16H14N4O4/c1-11-3-12(2)14(6-16(19-9-23)20-10-24)4-13(11)5-15(17-7-21)18-8-22/h3-4,15-16H,5-6H2,1-2H3 |
| InChIKey | ATFBCDBYHITEQZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|