C50H55F9O9S2 — CID 87491537
bis[3-[[2-(1-adamantyl)acetyl]oxymethoxy]-2-methylphenyl]-phenylsulfanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87491537) has the molecular formula C50H55F9O9S2 and a molecular weight of 1035.10 g/mol. Its IUPAC name is bis[3-[[2-(1-adamantyl)acetyl]oxymethoxy]-2-methylphenyl]-phenylsulfanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | bis[3-[[2-(1-adamantyl)acetyl]oxymethoxy]-2-methylphenyl]-phenylsulfanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87491537 |
| Molecular Formula | C50H55F9O9S2 |
| Molecular Weight | 1035.10 g/mol |
| Exact Mass | 1034.31 |
| IUPAC Name | bis[3-[[2-(1-adamantyl)acetyl]oxymethoxy]-2-methylphenyl]-phenylsulfanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | Cc1c(OCOC(=O)CC23CC4CC(CC(C4)C2)C3)cccc1[S+](c1ccccc1)c1cccc(OCOC(=O)CC23CC4CC(CC(C4)C2)C3)c1C.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C46H55O6S.C4HF9O3S/c1-30-39(49-28-51-43(47)26-45-20-32-14-33(21-45)16-34(15-32)22-45)10-6-12-41(30)53(38-8-4-3-5-9-38)42-13-7-11-40(31(42)2)50-29-52-44(48)27-46-23-35-17-36(24-46)19-37(18-35)25-46;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h3-13,32-37H,14-29H2,1-2H3;(H,14,15,16)/q+1;/p-1 |
| InChIKey | WAVXDBSJHMTKJN-UHFFFAOYSA-M |
| XLogP | 12.33 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.10 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|