C37H29F15O6S2 — CID 87491703
tert-butyl 2-[3,5-dimethyl-4-[[2,3,4,5,6-pentakis(trifluoromethyl)phenyl]sulfonyloxy-diphenyl-λ4-sulfanyl]phenoxy]acetate (PubChem CID 87491703) has the molecular formula C37H29F15O6S2 and a molecular weight of 918.74 g/mol. Its IUPAC name is tert-butyl 2-[3,5-dimethyl-4-[[2,3,4,5,6-pentakis(trifluoromethyl)phenyl]sulfonyloxy-diphenyl-λ4-sulfanyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[3,5-dimethyl-4-[[2,3,4,5,6-pentakis(trifluoromethyl)phenyl]sulfonyloxy-diphenyl-λ4-sulfanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 87491703 |
| Molecular Formula | C37H29F15O6S2 |
| Molecular Weight | 918.74 g/mol |
| Exact Mass | 918.12 |
| IUPAC Name | tert-butyl 2-[3,5-dimethyl-4-[[2,3,4,5,6-pentakis(trifluoromethyl)phenyl]sulfonyloxy-diphenyl-λ4-sulfanyl]phenoxy]acetate |
| SMILES | Cc1cc(OCC(=O)OC(C)(C)C)cc(C)c1S(OS(=O)(=O)c1c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H29F15O6S2/c1-19-16-21(56-18-24(53)57-32(3,4)5)17-20(2)30(19)59(22-12-8-6-9-13-22,23-14-10-7-11-15-23)58-60(54,55)31-28(36(47,48)49)26(34(41,42)43)25(33(38,39)40)27(35(44,45)46)29(31)37(50,51)52/h6-17H,18H2,1-5H3 |
| InChIKey | WQALIDAQMJYCIR-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.74 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |