C10H10N4 — CID 87491730
(5E,7Z,9E,11Z)-1H-tetrazino[1,6-a]azecine (PubChem CID 87491730) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is (5E,7Z,9E,11Z)-1H-tetrazino[1,6-a]azecine.
| Compound Name | (5E,7Z,9E,11Z)-1H-tetrazino[1,6-a]azecine |
|---|---|
| PubChem CID | 87491730 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (5E,7Z,9E,11Z)-1H-tetrazino[1,6-a]azecine |
| SMILES | C1=C2/C=C/C=C\C=C\C=C/N2NN=N1 |
| InChI | InChI=1S/C10H10N4/c1-2-4-6-8-14-10(7-5-3-1)9-11-12-13-14/h1-9H,(H,11,13)/b3-1-,4-2+,7-5+,8-6- |
| InChIKey | ZGVJJHMPDLBXKA-QPDKCPSBSA-N |
| XLogP | 2.21 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |