About cyclohepta[g]indole
cyclohepta[g]indole (PubChem CID 87491806) has the molecular formula C13H9N
and a molecular weight of 179.22 g/mol. Its IUPAC name is cyclohepta[g]indole.
Molecular Properties
| Compound Name | cyclohepta[g]indole |
| PubChem CID | 87491806 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | cyclohepta[g]indole |
| SMILES | c1ccc2ccc3ccnc3c2cc1 |
| InChI | InChI=1S/C13H9N/c1-2-4-10-6-7-11-8-9-14-13(11)12(10)5-3-1/h1-9H |
| InChIKey | YTNMNQSEKFLEII-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohepta[g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta[g]indole?
The IUPAC name of cyclohepta[g]indole (CID 87491806) is cyclohepta[g]indole.
What is the SMILES notation for cyclohepta[g]indole?
The canonical SMILES for cyclohepta[g]indole is c1ccc2ccc3ccnc3c2cc1.
What is the InChIKey of cyclohepta[g]indole?
The InChIKey is YTNMNQSEKFLEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N/c1-2-4-10-6-7-11-8-9-14-13(11)12(10)5-3-1/h1-9H.
What are the key properties of cyclohepta[g]indole?
cyclohepta[g]indole has a molecular weight of 179.22 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[g]indole is sourced from PubChem (CID 87491806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).