C11H10O5 — CID 87492043
2-[(1R,6R,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl]acetic acid (PubChem CID 87492043) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[(1R,6R,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl]acetic acid.
| Compound Name | 2-[(1R,6R,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl]acetic acid |
|---|---|
| PubChem CID | 87492043 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-[(1R,6R,7S)-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl]acetic acid |
| SMILES | O=C(O)CC12C(=O)OC(=O)[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C11H10O5/c12-7(13)4-11-6-2-1-5(3-6)8(11)9(14)16-10(11)15/h1-2,5-6,8H,3-4H2,(H,12,13)/t5-,6+,8+,11?/m1/s1 |
| InChIKey | AYQUZZFBHRSOKG-VUVJCXQHSA-N |
| XLogP | 0.35 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|