About 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile
2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 87492370) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile |
| PubChem CID | 87492370 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | C=CCNC1=CC(=C(C#N)C#N)CC(C)(C)C1 |
| InChI | InChI=1S/C14H17N3/c1-4-5-17-13-6-11(12(9-15)10-16)7-14(2,3)8-13/h4,6,17H,1,5,7-8H2,2-3H3 |
| InChIKey | UGDPHSTYGYMNCS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile?
The IUPAC name of 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile (CID 87492370) is 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile.
What is the SMILES notation for 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile?
The canonical SMILES for 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile is C=CCNC1=CC(=C(C#N)C#N)CC(C)(C)C1.
What is the InChIKey of 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile?
The InChIKey is UGDPHSTYGYMNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3/c1-4-5-17-13-6-11(12(9-15)10-16)7-14(2,3)8-13/h4,6,17H,1,5,7-8H2,2-3H3.
What are the key properties of 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile?
2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile has a molecular weight of 227.31 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]propanedinitrile is sourced from PubChem (CID 87492370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).