C13H14Br2N3O3S+ — CID 87492481
3-(1-amino-3,5-dibromopyrazin-1-ium-2-yl)-2,4,6-trimethylbenzenesulfonic acid (PubChem CID 87492481) has the molecular formula C13H14Br2N3O3S+ and a molecular weight of 452.15 g/mol. Its IUPAC name is 3-(1-amino-3,5-dibromopyrazin-1-ium-2-yl)-2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 3-(1-amino-3,5-dibromopyrazin-1-ium-2-yl)-2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87492481 |
| Molecular Formula | C13H14Br2N3O3S+ |
| Molecular Weight | 452.15 g/mol |
| Exact Mass | 449.91 |
| IUPAC Name | 3-(1-amino-3,5-dibromopyrazin-1-ium-2-yl)-2,4,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(C)c1-c1c(Br)nc(Br)c[n+]1N |
| InChI | InChI=1S/C13H13Br2N3O3S/c1-6-4-7(2)12(22(19,20)21)8(3)10(6)11-13(15)17-9(14)5-18(11)16/h4-5H,1-3H3,(H2-,16,17,19,20,21)/p+1 |
| InChIKey | CYZACJSIMCLAKW-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.15 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|