About (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride
(2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride (PubChem CID 87492673) has the molecular formula C10H20Cl2O
and a molecular weight of 227.17 g/mol. Its IUPAC name is (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride.
Molecular Properties
| Compound Name | (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride |
| PubChem CID | 87492673 |
| Molecular Formula | C10H20Cl2O |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride |
| SMILES | C=CCC[C@H](C)CC[C@H](O)CCl.Cl |
| InChI | InChI=1S/C10H19ClO.ClH/c1-3-4-5-9(2)6-7-10(12)8-11;/h3,9-10,12H,1,4-8H2,2H3;1H/t9-,10-;/m0./s1 |
| InChIKey | OFWJZFWXLOECQX-IYPAPVHQSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride?
The IUPAC name of (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride (CID 87492673) is (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride.
What is the SMILES notation for (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride?
The canonical SMILES for (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride is C=CCC[C@H](C)CC[C@H](O)CCl.Cl.
What is the InChIKey of (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride?
The InChIKey is OFWJZFWXLOECQX-IYPAPVHQSA-N. The full InChI is InChI=1S/C10H19ClO.ClH/c1-3-4-5-9(2)6-7-10(12)8-11;/h3,9-10,12H,1,4-8H2,2H3;1H/t9-,10-;/m0./s1.
What are the key properties of (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride?
(2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride has a molecular weight of 227.17 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-1-chloro-5-methylnon-8-en-2-ol;hydrochloride is sourced from PubChem (CID 87492673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).