About [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate
[[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate (PubChem CID 87492682) has the molecular formula C32H34F2O5S2
and a molecular weight of 600.75 g/mol. Its IUPAC name is [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate.
Molecular Properties
| Compound Name | [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate |
| PubChem CID | 87492682 |
| Molecular Formula | C32H34F2O5S2 |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate |
| SMILES | CC(C)(C)Oc1cccc(OC(C)(C)C)c1S(OS(=O)(=O)c1ccc(F)cc1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34F2O5S2/c1-31(2,3)37-27-18-13-19-28(38-32(4,5)6)30(27)40(24-14-9-7-10-15-24,25-16-11-8-12-17-25)39-41(35,36)29-21-20-23(33)22-26(29)34/h7-22H,1-6H3 |
| InChIKey | CCJOCZTXRQEFOZ-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate?
The IUPAC name of [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate (CID 87492682) is [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate.
What is the SMILES notation for [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate?
The canonical SMILES for [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate is CC(C)(C)Oc1cccc(OC(C)(C)C)c1S(OS(=O)(=O)c1ccc(F)cc1F)(c1ccccc1)c1ccccc1.
What is the InChIKey of [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate?
The InChIKey is CCJOCZTXRQEFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H34F2O5S2/c1-31(2,3)37-27-18-13-19-28(38-32(4,5)6)30(27)40(24-14-9-7-10-15-24,25-16-11-8-12-17-25)39-41(35,36)29-21-20-23(33)22-26(29)34/h7-22H,1-6H3.
What are the key properties of [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate?
[[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate has a molecular weight of 600.75 g/mol, XLogP of 8.92, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,6-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate is sourced from PubChem (CID 87492682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).