C7H12N4O4 — CID 87492893
propane-1,1,1,2-tetracarboxamide (PubChem CID 87492893) has the molecular formula C7H12N4O4 and a molecular weight of 216.20 g/mol. Its IUPAC name is propane-1,1,1,2-tetracarboxamide.
| Compound Name | propane-1,1,1,2-tetracarboxamide |
|---|---|
| PubChem CID | 87492893 |
| Molecular Formula | C7H12N4O4 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | propane-1,1,1,2-tetracarboxamide |
| SMILES | CC(C(N)=O)C(C(N)=O)(C(N)=O)C(N)=O |
| InChI | InChI=1S/C7H12N4O4/c1-2(3(8)12)7(4(9)13,5(10)14)6(11)15/h2H,1H3,(H2,8,12)(H2,9,13)(H2,10,14)(H2,11,15) |
| InChIKey | ALUMDSNLMRPTCN-UHFFFAOYSA-N |
| XLogP | -3.45 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|