C34H38FN5O6S — CID 87492981
3-[4-[3-[[3-[[4-[(1,5-dimethylpyrazole-3-carbonyl)amino]cyclohexyl]carbamoyl]-5-fluoro-2-pyridinyl]oxy]phenyl]phenyl]propyl methanesulfonate (PubChem CID 87492981) has the molecular formula C34H38FN5O6S and a molecular weight of 663.77 g/mol. Its IUPAC name is 3-[4-[3-[[3-[[4-[(1,5-dimethylpyrazole-3-carbonyl)amino]cyclohexyl]carbamoyl]-5-fluoro-2-pyridinyl]oxy]phenyl]phenyl]propyl methanesulfonate.
| Compound Name | 3-[4-[3-[[3-[[4-[(1,5-dimethylpyrazole-3-carbonyl)amino]cyclohexyl]carbamoyl]-5-fluoro-2-pyridinyl]oxy]phenyl]phenyl]propyl methanesulfonate |
|---|---|
| PubChem CID | 87492981 |
| Molecular Formula | C34H38FN5O6S |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 3-[4-[3-[[3-[[4-[(1,5-dimethylpyrazole-3-carbonyl)amino]cyclohexyl]carbamoyl]-5-fluoro-2-pyridinyl]oxy]phenyl]phenyl]propyl methanesulfonate |
| SMILES | Cc1cc(C(=O)NC2CCC(NC(=O)c3cc(F)cnc3Oc3cccc(-c4ccc(CCCOS(C)(=O)=O)cc4)c3)CC2)nn1C |
| InChI | InChI=1S/C34H38FN5O6S/c1-22-18-31(39-40(22)2)33(42)38-28-15-13-27(14-16-28)37-32(41)30-20-26(35)21-36-34(30)46-29-8-4-7-25(19-29)24-11-9-23(10-12-24)6-5-17-45-47(3,43)44/h4,7-12,18-21,27-28H,5-6,13-17H2,1-3H3,(H,37,41)(H,38,42) |
| InChIKey | KPHRFHUAFFMRFB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|