C35H27F15O4S2 — CID 87493031
[[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate (PubChem CID 87493031) has the molecular formula C35H27F15O4S2 and a molecular weight of 860.70 g/mol. Its IUPAC name is [[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate.
| Compound Name | [[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 87493031 |
| Molecular Formula | C35H27F15O4S2 |
| Molecular Weight | 860.70 g/mol |
| Exact Mass | 860.11 |
| IUPAC Name | [[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl] 2,3,4,5,6-pentakis(trifluoromethyl)benzenesulfonate |
| SMILES | Cc1cc(OC(C)(C)C)cc(C)c1S(OS(=O)(=O)c1c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H27F15O4S2/c1-18-16-20(53-30(3,4)5)17-19(2)28(18)55(21-12-8-6-9-13-21,22-14-10-7-11-15-22)54-56(51,52)29-26(34(45,46)47)24(32(39,40)41)23(31(36,37)38)25(33(42,43)44)27(29)35(48,49)50/h6-17H,1-5H3 |
| InChIKey | IXYVMZMMFGVGET-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.70 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |