About 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide
3-aminopropanoic acid;3-(prop-2-enylamino)propanamide (PubChem CID 87493085) has the molecular formula C9H19N3O3
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide.
Molecular Properties
| Compound Name | 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide |
| PubChem CID | 87493085 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide |
| SMILES | C=CCNCCC(N)=O.NCCC(=O)O |
| InChI | InChI=1S/C6H12N2O.C3H7NO2/c1-2-4-8-5-3-6(7)9;4-2-1-3(5)6/h2,8H,1,3-5H2,(H2,7,9);1-2,4H2,(H,5,6) |
| InChIKey | HIAPTJHNCFILET-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide?
The IUPAC name of 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide (CID 87493085) is 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide.
What is the SMILES notation for 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide?
The canonical SMILES for 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide is C=CCNCCC(N)=O.NCCC(=O)O.
What is the InChIKey of 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide?
The InChIKey is HIAPTJHNCFILET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C3H7NO2/c1-2-4-8-5-3-6(7)9;4-2-1-3(5)6/h2,8H,1,3-5H2,(H2,7,9);1-2,4H2,(H,5,6).
What are the key properties of 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide?
3-aminopropanoic acid;3-(prop-2-enylamino)propanamide has a molecular weight of 217.27 g/mol, XLogP of -0.94, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropanoic acid;3-(prop-2-enylamino)propanamide is sourced from PubChem (CID 87493085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).