C15H11Cl2F3N2O — CID 87493089
[8-(2,6-dichloro-3,5-difluorophenyl)-6-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl]methanamine (PubChem CID 87493089) has the molecular formula C15H11Cl2F3N2O and a molecular weight of 363.17 g/mol. Its IUPAC name is [8-(2,6-dichloro-3,5-difluorophenyl)-6-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl]methanamine.
| Compound Name | [8-(2,6-dichloro-3,5-difluorophenyl)-6-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl]methanamine |
|---|---|
| PubChem CID | 87493089 |
| Molecular Formula | C15H11Cl2F3N2O |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | [8-(2,6-dichloro-3,5-difluorophenyl)-6-fluoro-3,4-dihydro-2H-1,4-benzoxazin-2-yl]methanamine |
| SMILES | NCC1CNc2cc(F)cc(-c3c(Cl)c(F)cc(F)c3Cl)c2O1 |
| InChI | InChI=1S/C15H11Cl2F3N2O/c16-13-9(19)3-10(20)14(17)12(13)8-1-6(18)2-11-15(8)23-7(4-21)5-22-11/h1-3,7,22H,4-5,21H2 |
| InChIKey | YWHJFBRBLUBTOM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|