About [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate
[(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 87493131) has the molecular formula C27H23F3O3S2
and a molecular weight of 516.61 g/mol. Its IUPAC name is [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 87493131 |
| Molecular Formula | C27H23F3O3S2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | Cc1cccc(C)c1S(OS(=O)(=O)c1ccc(C(F)(F)F)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H23F3O3S2/c1-20-10-9-11-21(2)26(20)34(23-12-5-3-6-13-23,24-14-7-4-8-15-24)33-35(31,32)25-18-16-22(17-19-25)27(28,29)30/h3-19H,1-2H3 |
| InChIKey | ZDXXYIBPFHJATD-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate?
The IUPAC name of [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate (CID 87493131) is [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate is Cc1cccc(C)c1S(OS(=O)(=O)c1ccc(C(F)(F)F)cc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate?
The InChIKey is ZDXXYIBPFHJATD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23F3O3S2/c1-20-10-9-11-21(2)26(20)34(23-12-5-3-6-13-23,24-14-7-4-8-15-24)33-35(31,32)25-18-16-22(17-19-25)27(28,29)30/h3-19H,1-2H3.
What are the key properties of [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate?
[(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate has a molecular weight of 516.61 g/mol, XLogP of 7.92, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,6-dimethylphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 87493131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).