About 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine
1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine (PubChem CID 87493183) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine.
Molecular Properties
| Compound Name | 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine |
| PubChem CID | 87493183 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine |
| SMILES | [H]/N=C(\CCCC)c1ccccc1C1=C(C)C=C(C)C1 |
| InChI | InChI=1S/C18H23N/c1-4-5-10-18(19)16-9-7-6-8-15(16)17-12-13(2)11-14(17)3/h6-9,11,19H,4-5,10,12H2,1-3H3/b19-18+ |
| InChIKey | AGJNPHKODATJEM-VHEBQXMUSA-N |
| XLogP | 5.37 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine?
The IUPAC name of 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine (CID 87493183) is 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine.
What is the SMILES notation for 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine?
The canonical SMILES for 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine is [H]/N=C(\CCCC)c1ccccc1C1=C(C)C=C(C)C1.
What is the InChIKey of 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine?
The InChIKey is AGJNPHKODATJEM-VHEBQXMUSA-N. The full InChI is InChI=1S/C18H23N/c1-4-5-10-18(19)16-9-7-6-8-15(16)17-12-13(2)11-14(17)3/h6-9,11,19H,4-5,10,12H2,1-3H3/b19-18+.
What are the key properties of 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine?
1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine has a molecular weight of 253.39 g/mol, XLogP of 5.37, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]pentan-1-imine is sourced from PubChem (CID 87493183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).