C25H29N — CID 87493289
cyclohexyl-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)naphthalen-1-yl]methanimine (PubChem CID 87493289) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol. Its IUPAC name is cyclohexyl-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)naphthalen-1-yl]methanimine.
| Compound Name | cyclohexyl-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 87493289 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | cyclohexyl-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)naphthalen-1-yl]methanimine |
| SMILES | [H]/N=C(/c1c(C2=C(C)C(C)=CC2C)ccc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C25H29N/c1-16-15-17(2)23(18(16)3)22-14-13-19-9-7-8-12-21(19)24(22)25(26)20-10-5-4-6-11-20/h7-9,12-15,17,20,26H,4-6,10-11H2,1-3H3/b26-25+ |
| InChIKey | MZNZPYRSZABPTK-OCEACIFDSA-N |
| XLogP | 7.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|