C18H29N4O16P3 — CID 87493407
[1-amino-6-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-6-oxohexan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 87493407) has the molecular formula C18H29N4O16P3 and a molecular weight of 650.36 g/mol. Its IUPAC name is [1-amino-6-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-6-oxohexan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [1-amino-6-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-6-oxohexan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 87493407 |
| Molecular Formula | C18H29N4O16P3 |
| Molecular Weight | 650.36 g/mol |
| Exact Mass | 650.08 |
| IUPAC Name | [1-amino-6-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-6-oxohexan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | NCC(CCCC(=O)NCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](CO)O2)c1)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C18H29N4O16P3/c19-9-13(36-40(31,32)38-41(33,34)37-39(28,29)30)4-1-5-16(25)20-6-2-3-12-7-17(22(26)27)21(10-12)18-8-14(24)15(11-23)35-18/h7,10,13-15,18,23-24H,1,4-6,8-9,11,19H2,(H,20,25)(H,31,32)(H,33,34)(H2,28,29,30)/t13?,14-,15+,18+/m0/s1 |
| InChIKey | HTDCTPIVIXXPIJ-NQDXTSBESA-N |
| XLogP | -0.65 |
| TPSA | 312.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.36 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|