About N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid
N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid (PubChem CID 87493474) has the molecular formula C26H23N3O4
and a molecular weight of 441.49 g/mol. Its IUPAC name is N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid.
Molecular Properties
| Compound Name | N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid |
| PubChem CID | 87493474 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2nn(Cc3ccccc3)c3ccccc23)o1.ONCc1ccccc1 |
| InChI | InChI=1S/C19H14N2O3.C7H9NO/c22-19(23)17-11-10-16(24-17)18-14-8-4-5-9-15(14)21(20-18)12-13-6-2-1-3-7-13;9-8-6-7-4-2-1-3-5-7/h1-11H,12H2,(H,22,23);1-5,8-9H,6H2 |
| InChIKey | HJBHZEVQGNRFPA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid?
The IUPAC name of N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid (CID 87493474) is N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid.
What is the SMILES notation for N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid?
The canonical SMILES for N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid is O=C(O)c1ccc(-c2nn(Cc3ccccc3)c3ccccc23)o1.ONCc1ccccc1.
What is the InChIKey of N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid?
The InChIKey is HJBHZEVQGNRFPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O3.C7H9NO/c22-19(23)17-11-10-16(24-17)18-14-8-4-5-9-15(14)21(20-18)12-13-6-2-1-3-7-13;9-8-6-7-4-2-1-3-5-7/h1-11H,12H2,(H,22,23);1-5,8-9H,6H2.
What are the key properties of N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid?
N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid has a molecular weight of 441.49 g/mol, XLogP of 5.21, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylhydroxylamine;5-(1-benzylindazol-3-yl)furan-2-carboxylic acid is sourced from PubChem (CID 87493474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).